C21H20F3NO5S — CID 145156631
(1-hydroxy-8-oct-1-ynyl-3-oxo-1H-benzo[de]isoquinolin-2-yl) trifluoromethanesulfonate (PubChem CID 145156631) has the molecular formula C21H20F3NO5S and a molecular weight of 455.45 g/mol. Its IUPAC name is (1-hydroxy-8-oct-1-ynyl-3-oxo-1H-benzo[de]isoquinolin-2-yl) trifluoromethanesulfonate.
| Compound Name | (1-hydroxy-8-oct-1-ynyl-3-oxo-1H-benzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 145156631 |
| Molecular Formula | C21H20F3NO5S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | (1-hydroxy-8-oct-1-ynyl-3-oxo-1H-benzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
| SMILES | CCCCCCC#Cc1cc2c3c(cccc3c1)C(=O)N(OS(=O)(=O)C(F)(F)F)C2O |
| InChI | InChI=1S/C21H20F3NO5S/c1-2-3-4-5-6-7-9-14-12-15-10-8-11-16-18(15)17(13-14)20(27)25(19(16)26)30-31(28,29)21(22,23)24/h8,10-13,20,27H,2-6H2,1H3 |
| InChIKey | SSNZLLQJIVFUPJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|