C17H12F4N2O9S — CID 143852318
(5,12,13-trihydroxy-7,14-dioxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaen-6-yl) 1,1,2,2-tetrafluoro-3-hydroxypropane-1-sulfonate (PubChem CID 143852318) has the molecular formula C17H12F4N2O9S and a molecular weight of 496.35 g/mol. Its IUPAC name is (5,12,13-trihydroxy-7,14-dioxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaen-6-yl) 1,1,2,2-tetrafluoro-3-hydroxypropane-1-sulfonate.
| Compound Name | (5,12,13-trihydroxy-7,14-dioxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaen-6-yl) 1,1,2,2-tetrafluoro-3-hydroxypropane-1-sulfonate |
|---|---|
| PubChem CID | 143852318 |
| Molecular Formula | C17H12F4N2O9S |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | (5,12,13-trihydroxy-7,14-dioxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaen-6-yl) 1,1,2,2-tetrafluoro-3-hydroxypropane-1-sulfonate |
| SMILES | O=C1c2ccc3c4c(ccc(c24)C(O)N1O)C(=O)N(OS(=O)(=O)C(F)(F)C(F)(F)CO)C3O |
| InChI | InChI=1S/C17H12F4N2O9S/c18-16(19,5-24)17(20,21)33(30,31)32-23-14(27)8-3-1-6-10-7(13(26)22(29)12(6)25)2-4-9(11(8)10)15(23)28/h1-4,12,15,24-25,28-29H,5H2 |
| InChIKey | YKSCARCRQMIPCC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 164.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|