C17H16F3NO5S — CID 144635683
(7-butan-2-yl-1-hydroxy-3-oxo-1H-benzo[de]isoquinolin-2-yl) trifluoromethanesulfonate (PubChem CID 144635683) has the molecular formula C17H16F3NO5S and a molecular weight of 403.38 g/mol. Its IUPAC name is (7-butan-2-yl-1-hydroxy-3-oxo-1H-benzo[de]isoquinolin-2-yl) trifluoromethanesulfonate.
| Compound Name | (7-butan-2-yl-1-hydroxy-3-oxo-1H-benzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 144635683 |
| Molecular Formula | C17H16F3NO5S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | (7-butan-2-yl-1-hydroxy-3-oxo-1H-benzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
| SMILES | CCC(C)c1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)C(F)(F)F)C2O |
| InChI | InChI=1S/C17H16F3NO5S/c1-3-9(2)10-7-8-13-14-11(10)5-4-6-12(14)15(22)21(16(13)23)26-27(24,25)17(18,19)20/h4-9,16,23H,3H2,1-2H3 |
| InChIKey | UPLNROSLBDUEGC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|