C17H17NO3 — CID 71589842
2,3-dihydroxy-4-[(4-methylphenyl)methyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 71589842) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2,3-dihydroxy-4-[(4-methylphenyl)methyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2,3-dihydroxy-4-[(4-methylphenyl)methyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 71589842 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2,3-dihydroxy-4-[(4-methylphenyl)methyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | Cc1ccc(CC2c3ccccc3C(=O)N(O)C2O)cc1 |
| InChI | InChI=1S/C17H17NO3/c1-11-6-8-12(9-7-11)10-15-13-4-2-3-5-14(13)16(19)18(21)17(15)20/h2-9,15,17,20-21H,10H2,1H3 |
| InChIKey | WFYXYKMXOUBJRS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|