C16H23NO3 — CID 71589839
4-heptyl-2,3-dihydroxy-3,4-dihydroisoquinolin-1-one (PubChem CID 71589839) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 4-heptyl-2,3-dihydroxy-3,4-dihydroisoquinolin-1-one.
| Compound Name | 4-heptyl-2,3-dihydroxy-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 71589839 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 4-heptyl-2,3-dihydroxy-3,4-dihydroisoquinolin-1-one |
| SMILES | CCCCCCCC1c2ccccc2C(=O)N(O)C1O |
| InChI | InChI=1S/C16H23NO3/c1-2-3-4-5-6-10-13-12-9-7-8-11-14(12)16(19)17(20)15(13)18/h7-9,11,13,15,18,20H,2-6,10H2,1H3 |
| InChIKey | BIYXRHXMLKDGLC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|