C15H21NO3 — CID 71589838
4-hexyl-2,3-dihydroxy-3,4-dihydroisoquinolin-1-one (PubChem CID 71589838) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-hexyl-2,3-dihydroxy-3,4-dihydroisoquinolin-1-one.
| Compound Name | 4-hexyl-2,3-dihydroxy-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 71589838 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 4-hexyl-2,3-dihydroxy-3,4-dihydroisoquinolin-1-one |
| SMILES | CCCCCCC1c2ccccc2C(=O)N(O)C1O |
| InChI | InChI=1S/C15H21NO3/c1-2-3-4-5-9-12-11-8-6-7-10-13(11)15(18)16(19)14(12)17/h6-8,10,12,14,17,19H,2-5,9H2,1H3 |
| InChIKey | FYTRAQYBGDFDJC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|