C21H15F2NO6S — CID 172563373
(3,5-difluorophenyl) (11,12-dimethyl-2,4-dioxo-3-azatricyclo[7.4.1.05,14]tetradeca-1(13),5,7,9(14),10-pentaen-3-yl) sulfate (PubChem CID 172563373) has the molecular formula C21H15F2NO6S and a molecular weight of 447.42 g/mol. Its IUPAC name is (3,5-difluorophenyl) (11,12-dimethyl-2,4-dioxo-3-azatricyclo[7.4.1.05,14]tetradeca-1(13),5,7,9(14),10-pentaen-3-yl) sulfate.
| Compound Name | (3,5-difluorophenyl) (11,12-dimethyl-2,4-dioxo-3-azatricyclo[7.4.1.05,14]tetradeca-1(13),5,7,9(14),10-pentaen-3-yl) sulfate |
|---|---|
| PubChem CID | 172563373 |
| Molecular Formula | C21H15F2NO6S |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | (3,5-difluorophenyl) (11,12-dimethyl-2,4-dioxo-3-azatricyclo[7.4.1.05,14]tetradeca-1(13),5,7,9(14),10-pentaen-3-yl) sulfate |
| SMILES | CC1=Cc2cccc3c2C(=CC1C)C(=O)N(OS(=O)(=O)Oc1cc(F)cc(F)c1)C3=O |
| InChI | InChI=1S/C21H15F2NO6S/c1-11-6-13-4-3-5-17-19(13)18(7-12(11)2)21(26)24(20(17)25)30-31(27,28)29-16-9-14(22)8-15(23)10-16/h3-10,12H,1-2H3 |
| InChIKey | PTHDBLPLEWHCII-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|