(1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate

C18H11NO6S — CID 172563370

IUPAC(1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate
SMILESO=C1c2cccc3cccc(c23)C(=O)N1OS(=O)(=O)Oc1ccccc1
InChIInChI=1S/C18H11NO6S/c20-17-14-10-4-6-12-7-5-11-15(16(12)14)18(21)19(17)25-26(22,23)24-13-8-2-1-3-9-13/h1-11H
InChIKeyMKMCHVKERFAZLX-UHFFFAOYSA-N
MW369.35 g/mol
LogP2.69
Rot. Bonds4

About (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate

(1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate (PubChem CID 172563370) has the molecular formula C18H11NO6S and a molecular weight of 369.35 g/mol. Its IUPAC name is (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate.

Molecular Properties

Compound Name(1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate
PubChem CID172563370
Molecular FormulaC18H11NO6S
Molecular Weight369.35 g/mol
Exact Mass369.03
IUPAC Name(1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate
SMILESO=C1c2cccc3cccc(c23)C(=O)N1OS(=O)(=O)Oc1ccccc1
InChIInChI=1S/C18H11NO6S/c20-17-14-10-4-6-12-7-5-11-15(16(12)14)18(21)19(17)25-26(22,23)24-13-8-2-1-3-9-13/h1-11H
InChIKeyMKMCHVKERFAZLX-UHFFFAOYSA-N
XLogP2.69
TPSA89.98 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500369.35
LogP ≤ 52.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate?
The IUPAC name of (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate (CID 172563370) is (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate.
What is the SMILES notation for (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate?
The canonical SMILES for (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate is O=C1c2cccc3cccc(c23)C(=O)N1OS(=O)(=O)Oc1ccccc1.
What is the InChIKey of (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate?
The InChIKey is MKMCHVKERFAZLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11NO6S/c20-17-14-10-4-6-12-7-5-11-15(16(12)14)18(21)19(17)25-26(22,23)24-13-8-2-1-3-9-13/h1-11H.
What are the key properties of (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate?
(1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate has a molecular weight of 369.35 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate is sourced from PubChem (CID 172563370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).