C24H17F3N2O10S2 — CID 91243268
(1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate;(2,5-dioxopyrrolidin-1-yl) (4-methylphenyl) sulfite (PubChem CID 91243268) has the molecular formula C24H17F3N2O10S2 and a molecular weight of 614.53 g/mol. Its IUPAC name is (1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate;(2,5-dioxopyrrolidin-1-yl) (4-methylphenyl) sulfite.
| Compound Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate;(2,5-dioxopyrrolidin-1-yl) (4-methylphenyl) sulfite |
|---|---|
| PubChem CID | 91243268 |
| Molecular Formula | C24H17F3N2O10S2 |
| Molecular Weight | 614.53 g/mol |
| Exact Mass | 614.03 |
| IUPAC Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate;(2,5-dioxopyrrolidin-1-yl) (4-methylphenyl) sulfite |
| SMILES | Cc1ccc(OS(=O)ON2C(=O)CCC2=O)cc1.O=C1c2cccc3cccc(c23)C(=O)N1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H6F3NO5S.C11H11NO5S/c14-13(15,16)23(20,21)22-17-11(18)8-5-1-3-7-4-2-6-9(10(7)8)12(17)19;1-8-2-4-9(5-3-8)16-18(15)17-12-10(13)6-7-11(12)14/h1-6H;2-5H,6-7H2,1H3 |
| InChIKey | HIKJTUJVFUMVKX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 153.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|