C17H16F3NO6SSi — CID 142376921
[5-[ethyl(dimethyl)silyl]oxy-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate (PubChem CID 142376921) has the molecular formula C17H16F3NO6SSi and a molecular weight of 447.46 g/mol. Its IUPAC name is [5-[ethyl(dimethyl)silyl]oxy-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate.
| Compound Name | [5-[ethyl(dimethyl)silyl]oxy-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142376921 |
| Molecular Formula | C17H16F3NO6SSi |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | [5-[ethyl(dimethyl)silyl]oxy-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
| SMILES | CC[Si](C)(C)Oc1cc2c3c(cccc3c1)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O |
| InChI | InChI=1S/C17H16F3NO6SSi/c1-4-29(2,3)26-11-8-10-6-5-7-12-14(10)13(9-11)16(23)21(15(12)22)27-28(24,25)17(18,19)20/h5-9H,4H2,1-3H3 |
| InChIKey | KWRQWVWLYBAROK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|