C16H14F3NO6SSi — CID 142376884
(1,3-dioxo-5-trimethylsilyloxybenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate (PubChem CID 142376884) has the molecular formula C16H14F3NO6SSi and a molecular weight of 433.44 g/mol. Its IUPAC name is (1,3-dioxo-5-trimethylsilyloxybenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate.
| Compound Name | (1,3-dioxo-5-trimethylsilyloxybenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142376884 |
| Molecular Formula | C16H14F3NO6SSi |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | (1,3-dioxo-5-trimethylsilyloxybenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)Oc1cc2c3c(cccc3c1)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O |
| InChI | InChI=1S/C16H14F3NO6SSi/c1-28(2,3)25-10-7-9-5-4-6-11-13(9)12(8-10)15(22)20(14(11)21)26-27(23,24)16(17,18)19/h4-8H,1-3H3 |
| InChIKey | VXZSAPNUVYJNQU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|