C18H11NO5S — CID 22947350
(1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfite (PubChem CID 22947350) has the molecular formula C18H11NO5S and a molecular weight of 353.36 g/mol. Its IUPAC name is (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfite.
| Compound Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfite |
|---|---|
| PubChem CID | 22947350 |
| Molecular Formula | C18H11NO5S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfite |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1OS(=O)Oc1ccccc1 |
| InChI | InChI=1S/C18H11NO5S/c20-17-14-10-4-6-12-7-5-11-15(16(12)14)18(21)19(17)24-25(22)23-13-8-2-1-3-9-13/h1-11H |
| InChIKey | IFJDJWYRFZPFPW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|