C18H11NO5S — CID 59083527
2-phenylperoxysulfanyloxybenzo[de]isoquinoline-1,3-dione (PubChem CID 59083527) has the molecular formula C18H11NO5S and a molecular weight of 353.36 g/mol. Its IUPAC name is 2-phenylperoxysulfanyloxybenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-phenylperoxysulfanyloxybenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 59083527 |
| Molecular Formula | C18H11NO5S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 2-phenylperoxysulfanyloxybenzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1OSOOc1ccccc1 |
| InChI | InChI=1S/C18H11NO5S/c20-17-14-10-4-6-12-7-5-11-15(16(12)14)18(21)19(17)23-25-24-22-13-8-2-1-3-9-13/h1-11H |
| InChIKey | ZUPWYTHREYHRTP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|