C13H26F3N — CID 172565220
5-ethyl-10,10,10-trifluoro-7-methyldecan-1-amine (PubChem CID 172565220) has the molecular formula C13H26F3N and a molecular weight of 253.35 g/mol. Its IUPAC name is 5-ethyl-10,10,10-trifluoro-7-methyldecan-1-amine.
| Compound Name | 5-ethyl-10,10,10-trifluoro-7-methyldecan-1-amine |
|---|---|
| PubChem CID | 172565220 |
| Molecular Formula | C13H26F3N |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 5-ethyl-10,10,10-trifluoro-7-methyldecan-1-amine |
| SMILES | CCC(CCCCN)CC(C)CCC(F)(F)F |
| InChI | InChI=1S/C13H26F3N/c1-3-12(6-4-5-9-17)10-11(2)7-8-13(14,15)16/h11-12H,3-10,17H2,1-2H3 |
| InChIKey | PMDCPSJYKDCDNY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|