C26H25N3O6S — CID 172566194
N-[(4bR,9bR)-1-amino-7-[(1S,2R)-1,2-dimethylcyclopropyl]-4b-hydroxy-10-oxoindeno[1,2-b][1]benzofuran-9b-yl]-5-methylsulfonyl-1H-pyrrole-2-carboxamide (PubChem CID 172566194) has the molecular formula C26H25N3O6S and a molecular weight of 507.57 g/mol. Its IUPAC name is N-[(4bR,9bR)-1-amino-7-[(1S,2R)-1,2-dimethylcyclopropyl]-4b-hydroxy-10-oxoindeno[1,2-b][1]benzofuran-9b-yl]-5-methylsulfonyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(4bR,9bR)-1-amino-7-[(1S,2R)-1,2-dimethylcyclopropyl]-4b-hydroxy-10-oxoindeno[1,2-b][1]benzofuran-9b-yl]-5-methylsulfonyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 172566194 |
| Molecular Formula | C26H25N3O6S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | N-[(4bR,9bR)-1-amino-7-[(1S,2R)-1,2-dimethylcyclopropyl]-4b-hydroxy-10-oxoindeno[1,2-b][1]benzofuran-9b-yl]-5-methylsulfonyl-1H-pyrrole-2-carboxamide |
| SMILES | C[C@@H]1C[C@]1(C)c1ccc2c(c1)O[C@]1(O)c3cccc(N)c3C(=O)[C@]21NC(=O)c1ccc(S(C)(=O)=O)[nH]1 |
| InChI | InChI=1S/C26H25N3O6S/c1-13-12-24(13,2)14-7-8-15-19(11-14)35-26(32)16-5-4-6-17(27)21(16)22(30)25(15,26)29-23(31)18-9-10-20(28-18)36(3,33)34/h4-11,13,28,32H,12,27H2,1-3H3,(H,29,31)/t13-,24+,25-,26-/m1/s1 |
| InChIKey | CIMYPAUNZRLEJS-IRJWUMMUSA-N |
| XLogP | 2.36 |
| TPSA | 151.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|