C24H32N2O5S — CID 17256634
3,4-diethoxy-N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]benzamide (PubChem CID 17256634) has the molecular formula C24H32N2O5S and a molecular weight of 460.60 g/mol. Its IUPAC name is 3,4-diethoxy-N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 17256634 |
| Molecular Formula | C24H32N2O5S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 3,4-diethoxy-N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(S(=O)(=O)N3CCCCC3CC)cc2)cc1OCC |
| InChI | InChI=1S/C24H32N2O5S/c1-4-20-9-7-8-16-26(20)32(28,29)21-13-11-19(12-14-21)25-24(27)18-10-15-22(30-5-2)23(17-18)31-6-3/h10-15,17,20H,4-9,16H2,1-3H3,(H,25,27) |
| InChIKey | URCFTZQKOHUQGM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |