C23H30N2O5S — CID 2988784
2-(3,4-dimethoxyphenyl)-N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]acetamide (PubChem CID 2988784) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 2988784 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]acetamide |
| SMILES | CCC1CCCCN1S(=O)(=O)c1ccc(NC(=O)Cc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H30N2O5S/c1-4-19-7-5-6-14-25(19)31(27,28)20-11-9-18(10-12-20)24-23(26)16-17-8-13-21(29-2)22(15-17)30-3/h8-13,15,19H,4-7,14,16H2,1-3H3,(H,24,26) |
| InChIKey | RDBAFGYCZYOQBF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |