C18H32N2O2 — CID 172569679
N-[3-(3-aminophenyl)-5-[(2-methylpropan-2-yl)oxy]pentyl]formamide;ethane (PubChem CID 172569679) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is N-[3-(3-aminophenyl)-5-[(2-methylpropan-2-yl)oxy]pentyl]formamide;ethane.
| Compound Name | N-[3-(3-aminophenyl)-5-[(2-methylpropan-2-yl)oxy]pentyl]formamide;ethane |
|---|---|
| PubChem CID | 172569679 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | N-[3-(3-aminophenyl)-5-[(2-methylpropan-2-yl)oxy]pentyl]formamide;ethane |
| SMILES | CC.CC(C)(C)OCCC(CCNC=O)c1cccc(N)c1 |
| InChI | InChI=1S/C16H26N2O2.C2H6/c1-16(2,3)20-10-8-13(7-9-18-12-19)14-5-4-6-15(17)11-14;1-2/h4-6,11-13H,7-10,17H2,1-3H3,(H,18,19);1-2H3 |
| InChIKey | AEZOJKDEROGZTM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|