C37H47FN8S2 — CID 172570477
4-[4-[2-fluoro-3-(propylsulfanylamino)phenyl]-2-[3-[(1-pyridin-2-ylpiperidin-4-yl)methyl]-3-azaspiro[5.5]undecan-9-yl]-1,3-thiazol-5-yl]pyrimidin-2-amine (PubChem CID 172570477) has the molecular formula C37H47FN8S2 and a molecular weight of 686.97 g/mol. Its IUPAC name is 4-[4-[2-fluoro-3-(propylsulfanylamino)phenyl]-2-[3-[(1-pyridin-2-ylpiperidin-4-yl)methyl]-3-azaspiro[5.5]undecan-9-yl]-1,3-thiazol-5-yl]pyrimidin-2-amine.
| Compound Name | 4-[4-[2-fluoro-3-(propylsulfanylamino)phenyl]-2-[3-[(1-pyridin-2-ylpiperidin-4-yl)methyl]-3-azaspiro[5.5]undecan-9-yl]-1,3-thiazol-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 172570477 |
| Molecular Formula | C37H47FN8S2 |
| Molecular Weight | 686.97 g/mol |
| Exact Mass | 686.33 |
| IUPAC Name | 4-[4-[2-fluoro-3-(propylsulfanylamino)phenyl]-2-[3-[(1-pyridin-2-ylpiperidin-4-yl)methyl]-3-azaspiro[5.5]undecan-9-yl]-1,3-thiazol-5-yl]pyrimidin-2-amine |
| SMILES | CCCSNc1cccc(-c2nc(C3CCC4(CC3)CCN(CC3CCN(c5ccccn5)CC3)CC4)sc2-c2ccnc(N)n2)c1F |
| InChI | InChI=1S/C37H47FN8S2/c1-2-24-47-44-29-7-5-6-28(32(29)38)33-34(30-11-19-41-36(39)42-30)48-35(43-33)27-9-14-37(15-10-27)16-22-45(23-17-37)25-26-12-20-46(21-13-26)31-8-3-4-18-40-31/h3-8,11,18-19,26-27,44H,2,9-10,12-17,20-25H2,1H3,(H2,39,41,42) |
| InChIKey | VHOSSJXDGVQQEJ-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.97 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|