C20H16F3N5 — CID 172570883
5-[2-[[4-(trifluoromethyl)phenyl]methylamino]-4-pyridinyl]-1H-indazol-3-amine (PubChem CID 172570883) has the molecular formula C20H16F3N5 and a molecular weight of 383.38 g/mol. Its IUPAC name is 5-[2-[[4-(trifluoromethyl)phenyl]methylamino]-4-pyridinyl]-1H-indazol-3-amine.
| Compound Name | 5-[2-[[4-(trifluoromethyl)phenyl]methylamino]-4-pyridinyl]-1H-indazol-3-amine |
|---|---|
| PubChem CID | 172570883 |
| Molecular Formula | C20H16F3N5 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 5-[2-[[4-(trifluoromethyl)phenyl]methylamino]-4-pyridinyl]-1H-indazol-3-amine |
| SMILES | Nc1n[nH]c2ccc(-c3ccnc(NCc4ccc(C(F)(F)F)cc4)c3)cc12 |
| InChI | InChI=1S/C20H16F3N5/c21-20(22,23)15-4-1-12(2-5-15)11-26-18-10-14(7-8-25-18)13-3-6-17-16(9-13)19(24)28-27-17/h1-10H,11H2,(H,25,26)(H3,24,27,28) |
| InChIKey | VKYAYTPGMKDJNT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |