C14H21IO2 — CID 172571618
(1R,2S,4S,5R)-2-but-2-ynoxy-5-iodo-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane (PubChem CID 172571618) has the molecular formula C14H21IO2 and a molecular weight of 348.22 g/mol. Its IUPAC name is (1R,2S,4S,5R)-2-but-2-ynoxy-5-iodo-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane.
| Compound Name | (1R,2S,4S,5R)-2-but-2-ynoxy-5-iodo-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 172571618 |
| Molecular Formula | C14H21IO2 |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | (1R,2S,4S,5R)-2-but-2-ynoxy-5-iodo-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane |
| SMILES | CC#CCO[C@H]1C[C@@]2(C(C)C)O[C@]1(C)C[C@H]2I |
| InChI | InChI=1S/C14H21IO2/c1-5-6-7-16-12-9-14(10(2)3)11(15)8-13(12,4)17-14/h10-12H,7-9H2,1-4H3/t11-,12+,13-,14+/m1/s1 |
| InChIKey | YDMHZOAMFMPRMS-RQJABVFESA-N |
| XLogP | 3.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|