C14H19F3N2 — CID 172575288
3-[(Z)-4,6-dimethyl-5-methylidenehept-3-en-3-yl]imino-4,4,4-trifluorobutanenitrile (PubChem CID 172575288) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 3-[(Z)-4,6-dimethyl-5-methylidenehept-3-en-3-yl]imino-4,4,4-trifluorobutanenitrile.
| Compound Name | 3-[(Z)-4,6-dimethyl-5-methylidenehept-3-en-3-yl]imino-4,4,4-trifluorobutanenitrile |
|---|---|
| PubChem CID | 172575288 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3-[(Z)-4,6-dimethyl-5-methylidenehept-3-en-3-yl]imino-4,4,4-trifluorobutanenitrile |
| SMILES | C=C(/C(C)=C(CC)\N=C(/CC#N)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C14H19F3N2/c1-6-12(11(5)10(4)9(2)3)19-13(7-8-18)14(15,16)17/h9H,4,6-7H2,1-3,5H3/b12-11-,19-13+ |
| InChIKey | MUGOAZNPEFTJJA-FXGFNZPXSA-N |
| XLogP | 4.80 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|