C26H34N4O7 — CID 172575689
2-hydroxybutanedioate;bis(2-(5-methoxy-1H-indol-3-yl)ethylazanium) (PubChem CID 172575689) has the molecular formula C26H34N4O7 and a molecular weight of 514.58 g/mol. Its IUPAC name is 2-hydroxybutanedioate;bis(2-(5-methoxy-1H-indol-3-yl)ethylazanium).
| Compound Name | 2-hydroxybutanedioate;bis(2-(5-methoxy-1H-indol-3-yl)ethylazanium) |
|---|---|
| PubChem CID | 172575689 |
| Molecular Formula | C26H34N4O7 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 2-hydroxybutanedioate;bis(2-(5-methoxy-1H-indol-3-yl)ethylazanium) |
| SMILES | COc1ccc2[nH]cc(CC[NH3+])c2c1.COc1ccc2[nH]cc(CC[NH3+])c2c1.O=C([O-])CC(O)C(=O)[O-] |
| InChI | InChI=1S/2C11H14N2O.C4H6O5/c2*1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11;5-2(4(8)9)1-3(6)7/h2*2-3,6-7,13H,4-5,12H2,1H3;2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | CHTCBRSWQMYWSA-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 205.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |