C27H31N3O2 — CID 172577967
(6aR,9R)-N,N-diethyl-7-[[3-(trideuteriomethoxy)phenyl]methyl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 172577967) has the molecular formula C27H31N3O2 and a molecular weight of 432.58 g/mol. Its IUPAC name is (6aR,9R)-N,N-diethyl-7-[[3-(trideuteriomethoxy)phenyl]methyl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-N,N-diethyl-7-[[3-(trideuteriomethoxy)phenyl]methyl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 172577967 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | (6aR,9R)-N,N-diethyl-7-[[3-(trideuteriomethoxy)phenyl]methyl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | [2H]C([2H])([2H])Oc1cccc(CN2C[C@H](C(=O)N(CC)CC)C=C3c4cccc5[nH]cc(c45)C[C@H]32)c1 |
| InChI | InChI=1S/C27H31N3O2/c1-4-29(5-2)27(31)20-13-23-22-10-7-11-24-26(22)19(15-28-24)14-25(23)30(17-20)16-18-8-6-9-21(12-18)32-3/h6-13,15,20,25,28H,4-5,14,16-17H2,1-3H3/t20-,25-/m1/s1/i3D3 |
| InChIKey | KDRCBSBSNZORGF-XAQHZSSFSA-N |
| XLogP | 4.49 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |