C28H33N3O — CID 172578083
(6aR,9R)-N,N-diethyl-6a-methyl-7-[(3-methylphenyl)methyl]-4,6,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 172578083) has the molecular formula C28H33N3O and a molecular weight of 427.59 g/mol. Its IUPAC name is (6aR,9R)-N,N-diethyl-6a-methyl-7-[(3-methylphenyl)methyl]-4,6,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-N,N-diethyl-6a-methyl-7-[(3-methylphenyl)methyl]-4,6,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 172578083 |
| Molecular Formula | C28H33N3O |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (6aR,9R)-N,N-diethyl-6a-methyl-7-[(3-methylphenyl)methyl]-4,6,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@@]2(C)N(Cc2cccc(C)c2)C1 |
| InChI | InChI=1S/C28H33N3O/c1-5-30(6-2)27(32)21-14-24-23-11-8-12-25-26(23)22(16-29-25)15-28(24,4)31(18-21)17-20-10-7-9-19(3)13-20/h7-14,16,21,29H,5-6,15,17-18H2,1-4H3/t21-,28-/m1/s1 |
| InChIKey | RQRVZGLIWXDSHC-LYZGTLIUSA-N |
| XLogP | 5.17 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |