C25H31N5O2 — CID 172582197
[4-[(3,5-dimethyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]cyclohexyl]-[(3S)-3-(6-methyl-3-pyridinyl)-1,2-oxazolidin-2-yl]methanone (PubChem CID 172582197) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is [4-[(3,5-dimethyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]cyclohexyl]-[(3S)-3-(6-methyl-3-pyridinyl)-1,2-oxazolidin-2-yl]methanone.
| Compound Name | [4-[(3,5-dimethyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]cyclohexyl]-[(3S)-3-(6-methyl-3-pyridinyl)-1,2-oxazolidin-2-yl]methanone |
|---|---|
| PubChem CID | 172582197 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | [4-[(3,5-dimethyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]cyclohexyl]-[(3S)-3-(6-methyl-3-pyridinyl)-1,2-oxazolidin-2-yl]methanone |
| SMILES | Cc1ccc([C@@H]2CCON2C(=O)C2CCC(Cc3ccc4nnc(C)n4c3C)CC2)cn1 |
| InChI | InChI=1S/C25H31N5O2/c1-16-4-7-22(15-26-16)23-12-13-32-30(23)25(31)20-8-5-19(6-9-20)14-21-10-11-24-28-27-18(3)29(24)17(21)2/h4,7,10-11,15,19-20,23H,5-6,8-9,12-14H2,1-3H3/t19?,20?,23-/m0/s1 |
| InChIKey | DPDNQCRCMMIVLB-XPJNUEMQSA-N |
| XLogP | 4.30 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |