C25H29FN4O2 — CID 172581874
[4-[(3,7-dimethyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]cyclohexyl]-[(3S)-3-(3-fluorophenyl)-1,2-oxazolidin-2-yl]methanone (PubChem CID 172581874) has the molecular formula C25H29FN4O2 and a molecular weight of 436.53 g/mol. Its IUPAC name is [4-[(3,7-dimethyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]cyclohexyl]-[(3S)-3-(3-fluorophenyl)-1,2-oxazolidin-2-yl]methanone.
| Compound Name | [4-[(3,7-dimethyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]cyclohexyl]-[(3S)-3-(3-fluorophenyl)-1,2-oxazolidin-2-yl]methanone |
|---|---|
| PubChem CID | 172581874 |
| Molecular Formula | C25H29FN4O2 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | [4-[(3,7-dimethyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]cyclohexyl]-[(3S)-3-(3-fluorophenyl)-1,2-oxazolidin-2-yl]methanone |
| SMILES | Cc1cc2nnc(C)n2cc1CC1CCC(C(=O)N2OCC[C@H]2c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C25H29FN4O2/c1-16-12-24-28-27-17(2)29(24)15-21(16)13-18-6-8-19(9-7-18)25(31)30-23(10-11-32-30)20-4-3-5-22(26)14-20/h3-5,12,14-15,18-19,23H,6-11,13H2,1-2H3/t18?,19?,23-/m0/s1 |
| InChIKey | BYZFVVQOGAUGCN-XWEVFREBSA-N |
| XLogP | 4.74 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |