C10H11FN2O2 — CID 169273771
3-(3-fluorophenyl)-1,2-oxazolidine-2-carboxamide (PubChem CID 169273771) has the molecular formula C10H11FN2O2 and a molecular weight of 210.21 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1,2-oxazolidine-2-carboxamide.
| Compound Name | 3-(3-fluorophenyl)-1,2-oxazolidine-2-carboxamide |
|---|---|
| PubChem CID | 169273771 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 3-(3-fluorophenyl)-1,2-oxazolidine-2-carboxamide |
| SMILES | NC(=O)N1OCCC1c1cccc(F)c1 |
| InChI | InChI=1S/C10H11FN2O2/c11-8-3-1-2-7(6-8)9-4-5-15-13(9)10(12)14/h1-3,6,9H,4-5H2,(H2,12,14) |
| InChIKey | AEWLJFCEPALVOR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |