C18H16F3N5S — CID 172582405
3-(methyliminomethyl)-5-[6-[3-(trifluoromethyl)cyclobutyl]thieno[2,3-d]pyrimidin-2-yl]pyridin-2-amine (PubChem CID 172582405) has the molecular formula C18H16F3N5S and a molecular weight of 391.42 g/mol. Its IUPAC name is 3-(methyliminomethyl)-5-[6-[3-(trifluoromethyl)cyclobutyl]thieno[2,3-d]pyrimidin-2-yl]pyridin-2-amine.
| Compound Name | 3-(methyliminomethyl)-5-[6-[3-(trifluoromethyl)cyclobutyl]thieno[2,3-d]pyrimidin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 172582405 |
| Molecular Formula | C18H16F3N5S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 3-(methyliminomethyl)-5-[6-[3-(trifluoromethyl)cyclobutyl]thieno[2,3-d]pyrimidin-2-yl]pyridin-2-amine |
| SMILES | C/N=C/c1cc(-c2ncc3cc(C4CC(C(F)(F)F)C4)sc3n2)cnc1N |
| InChI | InChI=1S/C18H16F3N5S/c1-23-6-10-2-11(7-24-15(10)22)16-25-8-12-5-14(27-17(12)26-16)9-3-13(4-9)18(19,20)21/h2,5-9,13H,3-4H2,1H3,(H2,22,24)/b23-6+ |
| InChIKey | BMUVALGBTUEIFI-TXNBCWFRSA-N |
| XLogP | 4.44 |
| TPSA | 77.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|