C23H24N4O7S — CID 172582981
[4-[(3S)-3-(5-cyano-3-pyridinyl)-1,2-oxazolidine-2-carbonyl]cyclohexyl]methyl 4-nitrobenzenesulfonate (PubChem CID 172582981) has the molecular formula C23H24N4O7S and a molecular weight of 500.53 g/mol. Its IUPAC name is [4-[(3S)-3-(5-cyano-3-pyridinyl)-1,2-oxazolidine-2-carbonyl]cyclohexyl]methyl 4-nitrobenzenesulfonate.
| Compound Name | [4-[(3S)-3-(5-cyano-3-pyridinyl)-1,2-oxazolidine-2-carbonyl]cyclohexyl]methyl 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 172582981 |
| Molecular Formula | C23H24N4O7S |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | [4-[(3S)-3-(5-cyano-3-pyridinyl)-1,2-oxazolidine-2-carbonyl]cyclohexyl]methyl 4-nitrobenzenesulfonate |
| SMILES | N#Cc1cncc([C@@H]2CCON2C(=O)C2CCC(COS(=O)(=O)c3ccc([N+](=O)[O-])cc3)CC2)c1 |
| InChI | InChI=1S/C23H24N4O7S/c24-12-17-11-19(14-25-13-17)22-9-10-33-26(22)23(28)18-3-1-16(2-4-18)15-34-35(31,32)21-7-5-20(6-8-21)27(29)30/h5-8,11,13-14,16,18,22H,1-4,9-10,15H2/t16?,18?,22-/m0/s1 |
| InChIKey | RIASNUXYMGOXPH-QRFVXNFXSA-N |
| XLogP | 3.28 |
| TPSA | 152.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|