C21H24N4O7S — CID 172582771
[4-[(3S)-3-pyrazin-2-yl-1,2-oxazolidine-2-carbonyl]cyclohexyl]methyl 4-nitrobenzenesulfonate (PubChem CID 172582771) has the molecular formula C21H24N4O7S and a molecular weight of 476.51 g/mol. Its IUPAC name is [4-[(3S)-3-pyrazin-2-yl-1,2-oxazolidine-2-carbonyl]cyclohexyl]methyl 4-nitrobenzenesulfonate.
| Compound Name | [4-[(3S)-3-pyrazin-2-yl-1,2-oxazolidine-2-carbonyl]cyclohexyl]methyl 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 172582771 |
| Molecular Formula | C21H24N4O7S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | [4-[(3S)-3-pyrazin-2-yl-1,2-oxazolidine-2-carbonyl]cyclohexyl]methyl 4-nitrobenzenesulfonate |
| SMILES | O=C(C1CCC(COS(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1)N1OCC[C@H]1c1cnccn1 |
| InChI | InChI=1S/C21H24N4O7S/c26-21(24-20(9-12-31-24)19-13-22-10-11-23-19)16-3-1-15(2-4-16)14-32-33(29,30)18-7-5-17(6-8-18)25(27)28/h5-8,10-11,13,15-16,20H,1-4,9,12,14H2/t15?,16?,20-/m0/s1 |
| InChIKey | LCOFDWAWSCABNX-PMTKGXAQSA-N |
| XLogP | 2.80 |
| TPSA | 141.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|