C24H22N4O3 — CID 172583004
6-[7-[(3R)-3-hydroxypiperidine-1-carbonyl]quinoxalin-2-yl]-2-methylisoquinolin-1-one (PubChem CID 172583004) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 6-[7-[(3R)-3-hydroxypiperidine-1-carbonyl]quinoxalin-2-yl]-2-methylisoquinolin-1-one.
| Compound Name | 6-[7-[(3R)-3-hydroxypiperidine-1-carbonyl]quinoxalin-2-yl]-2-methylisoquinolin-1-one |
|---|---|
| PubChem CID | 172583004 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 6-[7-[(3R)-3-hydroxypiperidine-1-carbonyl]quinoxalin-2-yl]-2-methylisoquinolin-1-one |
| SMILES | Cn1ccc2cc(-c3cnc4ccc(C(=O)N5CCC[C@@H](O)C5)cc4n3)ccc2c1=O |
| InChI | InChI=1S/C24H22N4O3/c1-27-10-8-15-11-16(4-6-19(15)24(27)31)22-13-25-20-7-5-17(12-21(20)26-22)23(30)28-9-2-3-18(29)14-28/h4-8,10-13,18,29H,2-3,9,14H2,1H3/t18-/m1/s1 |
| InChIKey | OGGHRQDADCMRQF-GOSISDBHSA-N |
| XLogP | 2.75 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |