C8H10N4O — CID 172584055
4-methoxy-2,6-dimethylpyrazolo[3,4-d]pyrimidine (PubChem CID 172584055) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-methoxy-2,6-dimethylpyrazolo[3,4-d]pyrimidine.
| Compound Name | 4-methoxy-2,6-dimethylpyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 172584055 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 4-methoxy-2,6-dimethylpyrazolo[3,4-d]pyrimidine |
| SMILES | COc1nc(C)nc2nn(C)cc12 |
| InChI | InChI=1S/C8H10N4O/c1-5-9-7-6(4-12(2)11-7)8(10-5)13-3/h4H,1-3H3 |
| InChIKey | PYQXRAMXNWZGDT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |