C12H19F3N4 — CID 172584108
1-[1-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]piperidin-4-yl]ethanamine (PubChem CID 172584108) has the molecular formula C12H19F3N4 and a molecular weight of 276.31 g/mol. Its IUPAC name is 1-[1-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]piperidin-4-yl]ethanamine.
| Compound Name | 1-[1-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]piperidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 172584108 |
| Molecular Formula | C12H19F3N4 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-[1-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]piperidin-4-yl]ethanamine |
| SMILES | CC(N)C1CCN(c2nc(C(F)(F)F)cn2C)CC1 |
| InChI | InChI=1S/C12H19F3N4/c1-8(16)9-3-5-19(6-4-9)11-17-10(7-18(11)2)12(13,14)15/h7-9H,3-6,16H2,1-2H3 |
| InChIKey | VUHYHWAKUBYMOD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |