C10H14F3N3O — CID 172584100
1-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]piperidin-4-ol (PubChem CID 172584100) has the molecular formula C10H14F3N3O and a molecular weight of 249.24 g/mol. Its IUPAC name is 1-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]piperidin-4-ol.
| Compound Name | 1-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 172584100 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 1-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]piperidin-4-ol |
| SMILES | Cn1cc(C(F)(F)F)nc1N1CCC(O)CC1 |
| InChI | InChI=1S/C10H14F3N3O/c1-15-6-8(10(11,12)13)14-9(15)16-4-2-7(17)3-5-16/h6-7,17H,2-5H2,1H3 |
| InChIKey | XYBQJRWOCBVXJO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |