C27H27F4N7O2 — CID 172584568
(Z)-N-[[4-[[3-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1,2,4-triazonin-1-yl]oxymethyl]-2-fluorophenyl]methyl]-3,3,3-trifluoro-N-methyl-2-(methylideneamino)prop-1-en-1-amine (PubChem CID 172584568) has the molecular formula C27H27F4N7O2 and a molecular weight of 557.55 g/mol. Its IUPAC name is (Z)-N-[[4-[[3-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1,2,4-triazonin-1-yl]oxymethyl]-2-fluorophenyl]methyl]-3,3,3-trifluoro-N-methyl-2-(methylideneamino)prop-1-en-1-amine.
| Compound Name | (Z)-N-[[4-[[3-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1,2,4-triazonin-1-yl]oxymethyl]-2-fluorophenyl]methyl]-3,3,3-trifluoro-N-methyl-2-(methylideneamino)prop-1-en-1-amine |
|---|---|
| PubChem CID | 172584568 |
| Molecular Formula | C27H27F4N7O2 |
| Molecular Weight | 557.55 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | (Z)-N-[[4-[[3-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1,2,4-triazonin-1-yl]oxymethyl]-2-fluorophenyl]methyl]-3,3,3-trifluoro-N-methyl-2-(methylideneamino)prop-1-en-1-amine |
| SMILES | C=N/C(=C\N(C)Cc1ccc(COn2cccccnc(-c3c(OC)ncnc3C3CC3)n2)cc1F)C(F)(F)F |
| InChI | InChI=1S/C27H27F4N7O2/c1-32-22(27(29,30)31)15-37(2)14-20-8-7-18(13-21(20)28)16-40-38-12-6-4-5-11-33-25(36-38)23-24(19-9-10-19)34-17-35-26(23)39-3/h4-8,11-13,15,17,19H,1,9-10,14,16H2,2-3H3/b5-4-,12-6-,22-15-,33-11-,36-25- |
| InChIKey | HCHGMEKTPYLCHD-SRFPFBDSSA-N |
| XLogP | 5.05 |
| TPSA | 90.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|