C27H19B2F4N7O2 — CID 177004711
CID 177004711 (PubChem CID 177004711) has the molecular formula C27H19B2F4N7O2 and a molecular weight of 571.11 g/mol.
| Compound Name | CID 177004711 |
|---|---|
| PubChem CID | 177004711 |
| Molecular Formula | C27H19B2F4N7O2 |
| Molecular Weight | 571.11 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)n1cc(C(F)(F)F)nc1-c1ccc(Cc2nc(-c3c(OC)ncnc3C3CC3)nc3cccnc23)cc1F |
| InChI | InChI=1S/C27H19B2F4N7O2/c1-42-25-20(21(14-5-6-14)35-12-36-25)23-37-17-3-2-8-34-22(17)18(38-23)10-13-4-7-15(16(30)9-13)24-39-19(26(31,32)33)11-40(24)27(28,29)41/h2-4,7-9,11-12,14,41H,5-6,10H2,1H3 |
| InChIKey | HVUDHOUBUZGPLL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.11 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|