About CID 177004722
CID 177004722 (PubChem CID 177004722) has the molecular formula C29H25BF3N7O3
and a molecular weight of 587.37 g/mol.
Molecular Properties
| Compound Name | CID 177004722 |
| PubChem CID | 177004722 |
| Molecular Formula | C29H25BF3N7O3 |
| Molecular Weight | 587.37 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | — |
| SMILES | [B]C(O)(Oc1nc(-c2c(OC)ncnc2C2CC2)nc2cccnc12)c1ccc(-c2nc(C(F)(F)F)cn2C(C)C)cc1 |
| InChI | InChI=1S/C29H25BF3N7O3/c1-15(2)40-13-20(29(31,32)33)38-25(40)17-8-10-18(11-9-17)28(30,41)43-27-23-19(5-4-12-34-23)37-24(39-27)21-22(16-6-7-16)35-14-36-26(21)42-3/h4-5,8-16,41H,6-7H2,1-3H3 |
| InChIKey | BYAZXGAKCCNZNI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 587.37 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 177004722 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177004722?
The IUPAC name of CID 177004722 (CID 177004722) is not available.
What is the SMILES notation for CID 177004722?
The canonical SMILES for CID 177004722 is [B]C(O)(Oc1nc(-c2c(OC)ncnc2C2CC2)nc2cccnc12)c1ccc(-c2nc(C(F)(F)F)cn2C(C)C)cc1.
What is the InChIKey of CID 177004722?
The InChIKey is BYAZXGAKCCNZNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H25BF3N7O3/c1-15(2)40-13-20(29(31,32)33)38-25(40)17-8-10-18(11-9-17)28(30,41)43-27-23-19(5-4-12-34-23)37-24(39-27)21-22(16-6-7-16)35-14-36-26(21)42-3/h4-5,8-16,41H,6-7H2,1-3H3.
What are the key properties of CID 177004722?
CID 177004722 has a molecular weight of 587.37 g/mol, XLogP of 5.18, 8 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177004722 is sourced from PubChem (CID 177004722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).