C29H25BF3N7O3 — CID 177004722
CID 177004722 (PubChem CID 177004722) has the molecular formula C29H25BF3N7O3 and a molecular weight of 587.37 g/mol.
| Compound Name | CID 177004722 |
|---|---|
| PubChem CID | 177004722 |
| Molecular Formula | C29H25BF3N7O3 |
| Molecular Weight | 587.37 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | — |
| SMILES | [B]C(O)(Oc1nc(-c2c(OC)ncnc2C2CC2)nc2cccnc12)c1ccc(-c2nc(C(F)(F)F)cn2C(C)C)cc1 |
| InChI | InChI=1S/C29H25BF3N7O3/c1-15(2)40-13-20(29(31,32)33)38-25(40)17-8-10-18(11-9-17)28(30,41)43-27-23-19(5-4-12-34-23)37-24(39-27)21-22(16-6-7-16)35-14-36-26(21)42-3/h4-5,8-16,41H,6-7H2,1-3H3 |
| InChIKey | BYAZXGAKCCNZNI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.37 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|