C12H13F3N4OS — CID 172593106
2-[[3-ethyl-5-(trifluoromethyl)imidazol-4-yl]methylsulfanyl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 172593106) has the molecular formula C12H13F3N4OS and a molecular weight of 318.32 g/mol. Its IUPAC name is 2-[[3-ethyl-5-(trifluoromethyl)imidazol-4-yl]methylsulfanyl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[[3-ethyl-5-(trifluoromethyl)imidazol-4-yl]methylsulfanyl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 172593106 |
| Molecular Formula | C12H13F3N4OS |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-[[3-ethyl-5-(trifluoromethyl)imidazol-4-yl]methylsulfanyl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | CCn1cnc(C(F)(F)F)c1CSc1nc(C)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H13F3N4OS/c1-3-19-6-16-10(12(13,14)15)8(19)5-21-11-17-7(2)4-9(20)18-11/h4,6H,3,5H2,1-2H3,(H,17,18,20) |
| InChIKey | KXBZOFWQBVQTMR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |