C14H21BrN2O2S — CID 172594045
tert-butyl N-[(5-bromo-3-pyridinyl)methyl]-N-(2-methylsulfanylethyl)carbamate (PubChem CID 172594045) has the molecular formula C14H21BrN2O2S and a molecular weight of 361.31 g/mol. Its IUPAC name is tert-butyl N-[(5-bromo-3-pyridinyl)methyl]-N-(2-methylsulfanylethyl)carbamate.
| Compound Name | tert-butyl N-[(5-bromo-3-pyridinyl)methyl]-N-(2-methylsulfanylethyl)carbamate |
|---|---|
| PubChem CID | 172594045 |
| Molecular Formula | C14H21BrN2O2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | tert-butyl N-[(5-bromo-3-pyridinyl)methyl]-N-(2-methylsulfanylethyl)carbamate |
| SMILES | CSCCN(Cc1cncc(Br)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21BrN2O2S/c1-14(2,3)19-13(18)17(5-6-20-4)10-11-7-12(15)9-16-8-11/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | FMQCJQKIRLUABB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |