C20H23BrN2O4 — CID 150617844
[[3-(5-bromo-3-pyridinyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl acetate (PubChem CID 150617844) has the molecular formula C20H23BrN2O4 and a molecular weight of 435.32 g/mol. Its IUPAC name is [[3-(5-bromo-3-pyridinyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl acetate.
| Compound Name | [[3-(5-bromo-3-pyridinyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl acetate |
|---|---|
| PubChem CID | 150617844 |
| Molecular Formula | C20H23BrN2O4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | [[3-(5-bromo-3-pyridinyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl acetate |
| SMILES | CC(=O)OCN(Cc1cccc(-c2cncc(Br)c2)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H23BrN2O4/c1-14(24)26-13-23(19(25)27-20(2,3)4)12-15-6-5-7-16(8-15)17-9-18(21)11-22-10-17/h5-11H,12-13H2,1-4H3 |
| InChIKey | IVGMGMRFKBCOSS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|