C24H38N4O — CID 172594231
ethane;2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(pyridin-2-ylmethyl)ethanamine;prop-1-ene (PubChem CID 172594231) has the molecular formula C24H38N4O and a molecular weight of 398.60 g/mol. Its IUPAC name is ethane;2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(pyridin-2-ylmethyl)ethanamine;prop-1-ene.
| Compound Name | ethane;2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(pyridin-2-ylmethyl)ethanamine;prop-1-ene |
|---|---|
| PubChem CID | 172594231 |
| Molecular Formula | C24H38N4O |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | ethane;2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(pyridin-2-ylmethyl)ethanamine;prop-1-ene |
| SMILES | C=CC.CC.COc1ccc(N2CCN(CCNCc3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C19H26N4O.C3H6.C2H6/c1-24-19-7-5-18(6-8-19)23-14-12-22(13-15-23)11-10-20-16-17-4-2-3-9-21-17;1-3-2;1-2/h2-9,20H,10-16H2,1H3;3H,1H2,2H3;1-2H3 |
| InChIKey | YIZAVTQMPHHNPM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|