C11H10Cl2N4OS — CID 172595745
N-(3,3-dichlorocyclobutyl)-2-(1H-imidazol-5-yl)-1,3-thiazole-4-carboxamide (PubChem CID 172595745) has the molecular formula C11H10Cl2N4OS and a molecular weight of 317.20 g/mol. Its IUPAC name is N-(3,3-dichlorocyclobutyl)-2-(1H-imidazol-5-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3,3-dichlorocyclobutyl)-2-(1H-imidazol-5-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 172595745 |
| Molecular Formula | C11H10Cl2N4OS |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | N-(3,3-dichlorocyclobutyl)-2-(1H-imidazol-5-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC1CC(Cl)(Cl)C1)c1csc(-c2cnc[nH]2)n1 |
| InChI | InChI=1S/C11H10Cl2N4OS/c12-11(13)1-6(2-11)16-9(18)8-4-19-10(17-8)7-3-14-5-15-7/h3-6H,1-2H2,(H,14,15)(H,16,18) |
| InChIKey | QTHSXRXWNGPMGQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|