C34H52BrN7OS — CID 172595990
(Z)-2-amino-3-[1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidenequinazolin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]prop-2-enenitrile;sulfane (PubChem CID 172595990) has the molecular formula C34H52BrN7OS and a molecular weight of 686.81 g/mol. Its IUPAC name is (Z)-2-amino-3-[1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidenequinazolin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]prop-2-enenitrile;sulfane.
| Compound Name | (Z)-2-amino-3-[1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidenequinazolin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]prop-2-enenitrile;sulfane |
|---|---|
| PubChem CID | 172595990 |
| Molecular Formula | C34H52BrN7OS |
| Molecular Weight | 686.81 g/mol |
| Exact Mass | 685.31 |
| IUPAC Name | (Z)-2-amino-3-[1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidenequinazolin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]prop-2-enenitrile;sulfane |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(OCC(C)(CCCC)CCCCC)nc(N3CCCN=C(/C=C(\N)C#N)C3)c2\1.S |
| InChI | InChI=1S/C34H50BrN7O.H2S/c1-7-11-13-16-34(6,15-12-8-2)23-43-33-40-29-20-28(35)31(39-24(5)9-3)27(10-4)30(29)32(41-33)42-18-14-17-38-26(22-42)19-25(37)21-36;/h10,19-20,24H,7-9,11-18,22-23,37H2,1-6H3;1H2/b25-19-,27-10-,39-31-; |
| InChIKey | ZAIBODBFRFENAI-MYVGFJICSA-N |
| XLogP | 8.15 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.81 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|