C33H53BrN6OS — CID 172596105
(Z)-2-[1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidenequinazolin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]ethenamine;sulfane (PubChem CID 172596105) has the molecular formula C33H53BrN6OS and a molecular weight of 661.80 g/mol. Its IUPAC name is (Z)-2-[1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidenequinazolin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]ethenamine;sulfane.
| Compound Name | (Z)-2-[1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidenequinazolin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]ethenamine;sulfane |
|---|---|
| PubChem CID | 172596105 |
| Molecular Formula | C33H53BrN6OS |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 660.32 |
| IUPAC Name | (Z)-2-[1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidenequinazolin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]ethenamine;sulfane |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(OCC(C)(CCCC)CCCCC)nc(N3CCCN=C(/C=C\N)C3)c2\1.S |
| InChI | InChI=1S/C33H51BrN6O.H2S/c1-7-11-13-17-33(6,16-12-8-2)23-41-32-38-28-21-27(34)30(37-24(5)9-3)26(10-4)29(28)31(39-32)40-20-14-19-36-25(22-40)15-18-35;/h10,15,18,21,24H,7-9,11-14,16-17,19-20,22-23,35H2,1-6H3;1H2/b18-15-,26-10-,37-30-; |
| InChIKey | MKCSZRSADWXHDA-VAZPIRTQSA-N |
| XLogP | 8.26 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|