C19H24BrClN4O — CID 172596093
(5Z)-7-bromo-N-butan-2-yl-2-chloro-5-ethylidene-4-(1,4-oxazepan-4-yl)quinazolin-6-imine (PubChem CID 172596093) has the molecular formula C19H24BrClN4O and a molecular weight of 439.79 g/mol. Its IUPAC name is (5Z)-7-bromo-N-butan-2-yl-2-chloro-5-ethylidene-4-(1,4-oxazepan-4-yl)quinazolin-6-imine.
| Compound Name | (5Z)-7-bromo-N-butan-2-yl-2-chloro-5-ethylidene-4-(1,4-oxazepan-4-yl)quinazolin-6-imine |
|---|---|
| PubChem CID | 172596093 |
| Molecular Formula | C19H24BrClN4O |
| Molecular Weight | 439.79 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | (5Z)-7-bromo-N-butan-2-yl-2-chloro-5-ethylidene-4-(1,4-oxazepan-4-yl)quinazolin-6-imine |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(Cl)nc(N3CCCOCC3)c2\1 |
| InChI | InChI=1S/C19H24BrClN4O/c1-4-12(3)22-17-13(5-2)16-15(11-14(17)20)23-19(21)24-18(16)25-7-6-9-26-10-8-25/h5,11-12H,4,6-10H2,1-3H3/b13-5-,22-17- |
| InChIKey | HXAUBMZAOOKFBA-ZCQBXXKVSA-N |
| XLogP | 4.75 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.79 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|