C22H32ClN3O — CID 166164448
4-[2-chloro-6-[(3E,5E)-5-methylocta-3,5-dien-3-yl]-5H-cyclopenta[d]pyrimidin-4-yl]morpholine;ethane (PubChem CID 166164448) has the molecular formula C22H32ClN3O and a molecular weight of 389.97 g/mol. Its IUPAC name is 4-[2-chloro-6-[(3E,5E)-5-methylocta-3,5-dien-3-yl]-5H-cyclopenta[d]pyrimidin-4-yl]morpholine;ethane.
| Compound Name | 4-[2-chloro-6-[(3E,5E)-5-methylocta-3,5-dien-3-yl]-5H-cyclopenta[d]pyrimidin-4-yl]morpholine;ethane |
|---|---|
| PubChem CID | 166164448 |
| Molecular Formula | C22H32ClN3O |
| Molecular Weight | 389.97 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 4-[2-chloro-6-[(3E,5E)-5-methylocta-3,5-dien-3-yl]-5H-cyclopenta[d]pyrimidin-4-yl]morpholine;ethane |
| SMILES | CC.CC/C=C(C)/C=C(\CC)C1=Cc2nc(Cl)nc(N3CCOCC3)c2C1 |
| InChI | InChI=1S/C20H26ClN3O.C2H6/c1-4-6-14(3)11-15(5-2)16-12-17-18(13-16)22-20(21)23-19(17)24-7-9-25-10-8-24;1-2/h6,11,13H,4-5,7-10,12H2,1-3H3;1-2H3/b14-6+,15-11+; |
| InChIKey | PGXZGAQGVDVNSF-FTCVDCLJSA-N |
| XLogP | 5.62 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.97 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|