C21H32F2N4 — CID 159133572
2-butyl-7-[5-(4,4-difluoropiperidin-1-yl)pentyl]-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 159133572) has the molecular formula C21H32F2N4 and a molecular weight of 378.51 g/mol. Its IUPAC name is 2-butyl-7-[5-(4,4-difluoropiperidin-1-yl)pentyl]-5H-cyclopenta[d]pyrimidin-4-amine.
| Compound Name | 2-butyl-7-[5-(4,4-difluoropiperidin-1-yl)pentyl]-5H-cyclopenta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 159133572 |
| Molecular Formula | C21H32F2N4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 2-butyl-7-[5-(4,4-difluoropiperidin-1-yl)pentyl]-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | CCCCc1nc(N)c2c(n1)C(CCCCCN1CCC(F)(F)CC1)=CC2 |
| InChI | InChI=1S/C21H32F2N4/c1-2-3-8-18-25-19-16(9-10-17(19)20(24)26-18)7-5-4-6-13-27-14-11-21(22,23)12-15-27/h9H,2-8,10-15H2,1H3,(H2,24,25,26) |
| InChIKey | KHETUBODDHUDTR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|