C20H31FN4O — CID 158964925
7-[5-(4-fluoropiperidin-1-yl)pentyl]-2-(2-methoxyethyl)-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 158964925) has the molecular formula C20H31FN4O and a molecular weight of 362.49 g/mol. Its IUPAC name is 7-[5-(4-fluoropiperidin-1-yl)pentyl]-2-(2-methoxyethyl)-5H-cyclopenta[d]pyrimidin-4-amine.
| Compound Name | 7-[5-(4-fluoropiperidin-1-yl)pentyl]-2-(2-methoxyethyl)-5H-cyclopenta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 158964925 |
| Molecular Formula | C20H31FN4O |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 7-[5-(4-fluoropiperidin-1-yl)pentyl]-2-(2-methoxyethyl)-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | COCCc1nc(N)c2c(n1)C(CCCCCN1CCC(F)CC1)=CC2 |
| InChI | InChI=1S/C20H31FN4O/c1-26-14-10-18-23-19-15(6-7-17(19)20(22)24-18)5-3-2-4-11-25-12-8-16(21)9-13-25/h6,16H,2-5,7-14H2,1H3,(H2,22,23,24) |
| InChIKey | JNBSXPGCHLXBGH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|