C20H31FN4 — CID 149039299
2-butyl-7-[5-[(3S)-3-fluoropyrrolidin-1-yl]pentyl]-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 149039299) has the molecular formula C20H31FN4 and a molecular weight of 346.49 g/mol. Its IUPAC name is 2-butyl-7-[5-[(3S)-3-fluoropyrrolidin-1-yl]pentyl]-5H-cyclopenta[d]pyrimidin-4-amine.
| Compound Name | 2-butyl-7-[5-[(3S)-3-fluoropyrrolidin-1-yl]pentyl]-5H-cyclopenta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 149039299 |
| Molecular Formula | C20H31FN4 |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 2-butyl-7-[5-[(3S)-3-fluoropyrrolidin-1-yl]pentyl]-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | CCCCc1nc(N)c2c(n1)C(CCCCCN1CC[C@H](F)C1)=CC2 |
| InChI | InChI=1S/C20H31FN4/c1-2-3-8-18-23-19-15(9-10-17(19)20(22)24-18)7-5-4-6-12-25-13-11-16(21)14-25/h9,16H,2-8,10-14H2,1H3,(H2,22,23,24)/t16-/m0/s1 |
| InChIKey | QHGGXWRPIAWQRM-INIZCTEOSA-N |
| XLogP | 3.95 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|